C28H31FN4O2 — CID 142223038
8-[[(Z)-2-ethylhept-5-enoyl]amino]-1-(4-fluoro-3-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 142223038) has the molecular formula C28H31FN4O2 and a molecular weight of 474.58 g/mol. Its IUPAC name is 8-[[(Z)-2-ethylhept-5-enoyl]amino]-1-(4-fluoro-3-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[[(Z)-2-ethylhept-5-enoyl]amino]-1-(4-fluoro-3-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 142223038 |
| Molecular Formula | C28H31FN4O2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 8-[[(Z)-2-ethylhept-5-enoyl]amino]-1-(4-fluoro-3-methylphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | C/C=C\CCC(CC)C(=O)Nc1ccc2c(c1)-c1c(c(C(N)=O)nn1-c1ccc(F)c(C)c1)CC2 |
| InChI | InChI=1S/C28H31FN4O2/c1-4-6-7-8-18(5-2)28(35)31-20-11-9-19-10-13-22-25(27(30)34)32-33(26(22)23(19)16-20)21-12-14-24(29)17(3)15-21/h4,6,9,11-12,14-16,18H,5,7-8,10,13H2,1-3H3,(H2,30,34)(H,31,35)/b6-4- |
| InChIKey | OLJMSMNZSVAEFE-XQRVVYSFSA-N |
| XLogP | 5.51 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|