C21H29N — CID 142223798
4-ethyl-3,4,5-trimethyl-1-naphthalen-2-ylhex-5-en-2-amine (PubChem CID 142223798) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 4-ethyl-3,4,5-trimethyl-1-naphthalen-2-ylhex-5-en-2-amine.
| Compound Name | 4-ethyl-3,4,5-trimethyl-1-naphthalen-2-ylhex-5-en-2-amine |
|---|---|
| PubChem CID | 142223798 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 4-ethyl-3,4,5-trimethyl-1-naphthalen-2-ylhex-5-en-2-amine |
| SMILES | C=C(C)C(C)(CC)C(C)C(N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H29N/c1-6-21(5,15(2)3)16(4)20(22)14-17-11-12-18-9-7-8-10-19(18)13-17/h7-13,16,20H,2,6,14,22H2,1,3-5H3 |
| InChIKey | LXAXYQRKGIWVPB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|