C23H21F2N3O2 — CID 142224945
5-(2,2-difluoroethoxy)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-methyl-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 142224945) has the molecular formula C23H21F2N3O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-methyl-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | 5-(2,2-difluoroethoxy)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-methyl-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142224945 |
| Molecular Formula | C23H21F2N3O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-7-methyl-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2c(OCC(F)F)cc(C)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H21F2N3O2/c1-4-9-16(5-2)27-21-13-18(29)22-19(30-14-20(24)25)12-15(3)26-23(22)28(21)17-10-7-6-8-11-17/h4-13,20,27H,1-2,14H2,3H3/b16-9+ |
| InChIKey | POTFDDFGRWZLTH-CXUHLZMHSA-N |
| XLogP | 5.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|