C16H17F2N3O2 — CID 5330845
(2,6-diamino-4-butoxy-3-pyridinyl)-(2,6-difluorophenyl)methanone (PubChem CID 5330845) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2,6-diamino-4-butoxy-3-pyridinyl)-(2,6-difluorophenyl)methanone.
| Compound Name | (2,6-diamino-4-butoxy-3-pyridinyl)-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 5330845 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2,6-diamino-4-butoxy-3-pyridinyl)-(2,6-difluorophenyl)methanone |
| SMILES | CCCCOc1cc(N)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H17F2N3O2/c1-2-3-7-23-11-8-12(19)21-16(20)14(11)15(22)13-9(17)5-4-6-10(13)18/h4-6,8H,2-3,7H2,1H3,(H4,19,20,21) |
| InChIKey | PBOMECATNUOKSF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|