C25H28F2N4O2 — CID 21054900
[2-amino-4-butoxy-6-[4-[(dimethylamino)methyl]anilino]-3-pyridinyl]-(2,6-difluorophenyl)methanone (PubChem CID 21054900) has the molecular formula C25H28F2N4O2 and a molecular weight of 454.52 g/mol. Its IUPAC name is [2-amino-4-butoxy-6-[4-[(dimethylamino)methyl]anilino]-3-pyridinyl]-(2,6-difluorophenyl)methanone.
| Compound Name | [2-amino-4-butoxy-6-[4-[(dimethylamino)methyl]anilino]-3-pyridinyl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 21054900 |
| Molecular Formula | C25H28F2N4O2 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | [2-amino-4-butoxy-6-[4-[(dimethylamino)methyl]anilino]-3-pyridinyl]-(2,6-difluorophenyl)methanone |
| SMILES | CCCCOc1cc(Nc2ccc(CN(C)C)cc2)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C25H28F2N4O2/c1-4-5-13-33-20-14-21(29-17-11-9-16(10-12-17)15-31(2)3)30-25(28)23(20)24(32)22-18(26)7-6-8-19(22)27/h6-12,14H,4-5,13,15H2,1-3H3,(H3,28,29,30) |
| InChIKey | WUQBPPFBYGGZJZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|