C28H32F2N4O4 — CID 21054908
tert-butyl N-[[4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]methyl]carbamate (PubChem CID 21054908) has the molecular formula C28H32F2N4O4 and a molecular weight of 526.58 g/mol. Its IUPAC name is tert-butyl N-[[4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 21054908 |
| Molecular Formula | C28H32F2N4O4 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | tert-butyl N-[[4-[[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]amino]phenyl]methyl]carbamate |
| SMILES | CCCCOc1cc(Nc2ccc(CNC(=O)OC(C)(C)C)cc2)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C28H32F2N4O4/c1-5-6-14-37-21-15-22(34-26(31)24(21)25(35)23-19(29)8-7-9-20(23)30)33-18-12-10-17(11-13-18)16-32-27(36)38-28(2,3)4/h7-13,15H,5-6,14,16H2,1-4H3,(H,32,36)(H3,31,33,34) |
| InChIKey | UDRJTWMNQZGAQQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|