C23H21F2N3O3 — CID 11407631
N-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]benzamide (PubChem CID 11407631) has the molecular formula C23H21F2N3O3 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]benzamide.
| Compound Name | N-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 11407631 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[6-amino-4-butoxy-5-(2,6-difluorobenzoyl)-2-pyridinyl]benzamide |
| SMILES | CCCCOc1cc(NC(=O)c2ccccc2)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C23H21F2N3O3/c1-2-3-12-31-17-13-18(28-23(30)14-8-5-4-6-9-14)27-22(26)20(17)21(29)19-15(24)10-7-11-16(19)25/h4-11,13H,2-3,12H2,1H3,(H3,26,27,28,30) |
| InChIKey | IMNSBJWOSQQBHB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|