C26H33F2N3O6 — CID 21054907
tert-butyl N-[4-butoxy-3-(2,6-difluorobenzoyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate (PubChem CID 21054907) has the molecular formula C26H33F2N3O6 and a molecular weight of 521.56 g/mol. Its IUPAC name is tert-butyl N-[4-butoxy-3-(2,6-difluorobenzoyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-butoxy-3-(2,6-difluorobenzoyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 21054907 |
| Molecular Formula | C26H33F2N3O6 |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | tert-butyl N-[4-butoxy-3-(2,6-difluorobenzoyl)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate |
| SMILES | CCCCOc1cc(NC(=O)OC(C)(C)C)nc(NC(=O)OC(C)(C)C)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C26H33F2N3O6/c1-8-9-13-35-17-14-18(30-23(33)36-25(2,3)4)29-22(31-24(34)37-26(5,6)7)20(17)21(32)19-15(27)11-10-12-16(19)28/h10-12,14H,8-9,13H2,1-7H3,(H2,29,30,31,33,34) |
| InChIKey | CHRUHNHHXSILJK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|