C23H24F2N4O2 — CID 21054901
[2-amino-6-[4-(aminomethyl)anilino]-4-butoxy-3-pyridinyl]-(2,6-difluorophenyl)methanone (PubChem CID 21054901) has the molecular formula C23H24F2N4O2 and a molecular weight of 426.47 g/mol. Its IUPAC name is [2-amino-6-[4-(aminomethyl)anilino]-4-butoxy-3-pyridinyl]-(2,6-difluorophenyl)methanone.
| Compound Name | [2-amino-6-[4-(aminomethyl)anilino]-4-butoxy-3-pyridinyl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 21054901 |
| Molecular Formula | C23H24F2N4O2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [2-amino-6-[4-(aminomethyl)anilino]-4-butoxy-3-pyridinyl]-(2,6-difluorophenyl)methanone |
| SMILES | CCCCOc1cc(Nc2ccc(CN)cc2)nc(N)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C23H24F2N4O2/c1-2-3-11-31-18-12-19(28-15-9-7-14(13-26)8-10-15)29-23(27)21(18)22(30)20-16(24)5-4-6-17(20)25/h4-10,12H,2-3,11,13,26H2,1H3,(H3,27,28,29) |
| InChIKey | GWSBZMATCPGOES-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|