C28H32N4O — CID 142225531
1-benzyl-2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5-methyl-7-piperidin-1-yl-1,8-naphthyridin-4-one (PubChem CID 142225531) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-benzyl-2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5-methyl-7-piperidin-1-yl-1,8-naphthyridin-4-one.
| Compound Name | 1-benzyl-2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5-methyl-7-piperidin-1-yl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142225531 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1-benzyl-2-[[(2E)-2-ethenylpenta-2,4-dienyl]amino]-5-methyl-7-piperidin-1-yl-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)CNc1cc(=O)c2c(C)cc(N3CCCCC3)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C28H32N4O/c1-4-12-22(5-2)19-29-25-18-24(33)27-21(3)17-26(31-15-10-7-11-16-31)30-28(27)32(25)20-23-13-8-6-9-14-23/h4-6,8-9,12-14,17-18,29H,1-2,7,10-11,15-16,19-20H2,3H3/b22-12+ |
| InChIKey | DSJNLPIYDYPPEP-WSDLNYQXSA-N |
| XLogP | 5.45 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|