C25H25F2N3O2 — CID 142225562
2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,8-naphthyridin-4-one (PubChem CID 142225562) has the molecular formula C25H25F2N3O2 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,8-naphthyridin-4-one.
| Compound Name | 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142225562 |
| Molecular Formula | C25H25F2N3O2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C\C(=C/CC)n1c(Nc2ccccc2)cc(=O)c2c(OCC(F)F)cc(C)nc21 |
| InChI | InChI=1S/C25H25F2N3O2/c1-4-6-13-19(10-5-2)30-23(29-18-11-8-7-9-12-18)15-20(31)24-21(32-16-22(26)27)14-17(3)28-25(24)30/h4,6-15,22,29H,1,5,16H2,2-3H3/b13-6-,19-10+ |
| InChIKey | PYPDMFDMKCJCGT-YBPLMPTBSA-N |
| XLogP | 6.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|