C33H39N5O3 — CID 142226013
N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[2-(4-tert-butylphenyl)-6-pyridin-4-yl-3H-pyridazin-4-yl]pentanamide (PubChem CID 142226013) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[2-(4-tert-butylphenyl)-6-pyridin-4-yl-3H-pyridazin-4-yl]pentanamide.
| Compound Name | N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[2-(4-tert-butylphenyl)-6-pyridin-4-yl-3H-pyridazin-4-yl]pentanamide |
|---|---|
| PubChem CID | 142226013 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[2-(4-tert-butylphenyl)-6-pyridin-4-yl-3H-pyridazin-4-yl]pentanamide |
| SMILES | CC(C)(C)c1ccc(N2CC(CCCCC(=O)NC(Cc3ccc(O)cc3)C(N)=O)=CC(c3ccncc3)=N2)cc1 |
| InChI | InChI=1S/C33H39N5O3/c1-33(2,3)26-10-12-27(13-11-26)38-22-24(21-29(37-38)25-16-18-35-19-17-25)6-4-5-7-31(40)36-30(32(34)41)20-23-8-14-28(39)15-9-23/h8-19,21,30,39H,4-7,20,22H2,1-3H3,(H2,34,41)(H,36,40) |
| InChIKey | OVPPNTDLLSDFSW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|