C31H36N6O4 — CID 69251498
N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-4-[[1-(4-tert-butylphenyl)-3-(1-oxidopyridin-1-ium-4-yl)pyrazol-5-yl]amino]butanamide (PubChem CID 69251498) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-4-[[1-(4-tert-butylphenyl)-3-(1-oxidopyridin-1-ium-4-yl)pyrazol-5-yl]amino]butanamide.
| Compound Name | N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-4-[[1-(4-tert-butylphenyl)-3-(1-oxidopyridin-1-ium-4-yl)pyrazol-5-yl]amino]butanamide |
|---|---|
| PubChem CID | 69251498 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-4-[[1-(4-tert-butylphenyl)-3-(1-oxidopyridin-1-ium-4-yl)pyrazol-5-yl]amino]butanamide |
| SMILES | CC(C)(C)c1ccc(-n2nc(-c3cc[n+]([O-])cc3)cc2NCCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C31H36N6O4/c1-31(2,3)23-8-10-24(11-9-23)37-28(20-26(35-37)22-14-17-36(41)18-15-22)33-16-4-5-29(39)34-27(30(32)40)19-21-6-12-25(38)13-7-21/h6-15,17-18,20,27,33,38H,4-5,16,19H2,1-3H3,(H2,32,40)(H,34,39)/t27-/m0/s1 |
| InChIKey | ORSDDJBBBPRFHF-MHZLTWQESA-N |
| XLogP | 3.58 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|