C34H40N6O3 — CID 69248749
4-[(2S)-3-amino-2-[6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanoylamino]-3-oxopropyl]benzamide (PubChem CID 69248749) has the molecular formula C34H40N6O3 and a molecular weight of 580.73 g/mol. Its IUPAC name is 4-[(2S)-3-amino-2-[6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanoylamino]-3-oxopropyl]benzamide.
| Compound Name | 4-[(2S)-3-amino-2-[6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanoylamino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 69248749 |
| Molecular Formula | C34H40N6O3 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 4-[(2S)-3-amino-2-[6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanoylamino]-3-oxopropyl]benzamide |
| SMILES | CC(C)(C)c1ccc(-n2nc(-c3ccccn3)cc2CCCCCC(=O)N[C@@H](Cc2ccc(C(N)=O)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C34H40N6O3/c1-34(2,3)25-16-18-26(19-17-25)40-27(22-29(39-40)28-10-7-8-20-37-28)9-5-4-6-11-31(41)38-30(33(36)43)21-23-12-14-24(15-13-23)32(35)42/h7-8,10,12-20,22,30H,4-6,9,11,21H2,1-3H3,(H2,35,42)(H2,36,43)(H,38,41)/t30-/m0/s1 |
| InChIKey | DENGJKOMLWKSAP-PMERELPUSA-N |
| XLogP | 4.65 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|