C35H43N5O3 — CID 20810362
N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide (PubChem CID 20810362) has the molecular formula C35H43N5O3 and a molecular weight of 581.76 g/mol. Its IUPAC name is N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide.
| Compound Name | N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 20810362 |
| Molecular Formula | C35H43N5O3 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | N-[1-(butylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-2-ylpyrazol-5-yl]pentanamide |
| SMILES | CCCCNC(=O)C(Cc1ccc(O)cc1)NC(=O)CCCCc1cc(-c2ccccn2)nn1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C35H43N5O3/c1-4-5-21-37-35(43)33(23-26-13-19-30(41)20-14-26)38-34(42)12-7-6-10-29-24-32(31-11-8-9-22-36-31)39-40(29)28-17-15-27(16-18-28)25(2)3/h8-9,11,13-20,22,24-25,33,41H,4-7,10,12,21,23H2,1-3H3,(H,37,43)(H,38,42) |
| InChIKey | IFTYTODEABEVLL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|