C31H35N5O3 — CID 22385851
N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-3-ylpyrazol-5-yl]pentanamide (PubChem CID 22385851) has the molecular formula C31H35N5O3 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-3-ylpyrazol-5-yl]pentanamide.
| Compound Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-3-ylpyrazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 22385851 |
| Molecular Formula | C31H35N5O3 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-[1-(4-propan-2-ylphenyl)-3-pyridin-3-ylpyrazol-5-yl]pentanamide |
| SMILES | CC(C)c1ccc(-n2nc(-c3cccnc3)cc2CCCCC(=O)NC(=O)C(N)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H35N5O3/c1-21(2)23-11-13-25(14-12-23)36-26(19-29(35-36)24-6-5-17-33-20-24)7-3-4-8-30(38)34-31(39)28(32)18-22-9-15-27(37)16-10-22/h5-6,9-17,19-21,28,37H,3-4,7-8,18,32H2,1-2H3,(H,34,38,39) |
| InChIKey | YWBKOZLVOMXEAJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|