C30H35N5O3 — CID 22385800
N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-(1-butyl-3-quinolin-6-ylpyrazol-5-yl)pentanamide (PubChem CID 22385800) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-(1-butyl-3-quinolin-6-ylpyrazol-5-yl)pentanamide.
| Compound Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-(1-butyl-3-quinolin-6-ylpyrazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 22385800 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-5-(1-butyl-3-quinolin-6-ylpyrazol-5-yl)pentanamide |
| SMILES | CCCCn1nc(-c2ccc3ncccc3c2)cc1CCCCC(=O)NC(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C30H35N5O3/c1-2-3-17-35-24(20-28(34-35)23-12-15-27-22(19-23)7-6-16-32-27)8-4-5-9-29(37)33-30(38)26(31)18-21-10-13-25(36)14-11-21/h6-7,10-16,19-20,26,36H,2-5,8-9,17-18,31H2,1H3,(H,33,37,38) |
| InChIKey | RJERKMPQFHEYER-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|