C31H36N6O3 — CID 22385838
N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]amino]butanamide (PubChem CID 22385838) has the molecular formula C31H36N6O3 and a molecular weight of 540.67 g/mol. Its IUPAC name is N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]amino]butanamide.
| Compound Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]amino]butanamide |
|---|---|
| PubChem CID | 22385838 |
| Molecular Formula | C31H36N6O3 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]amino]butanamide |
| SMILES | CC(C)(C)c1ccc(-n2nc(-c3cccnc3)cc2NCCCC(=O)NC(=O)C(N)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C31H36N6O3/c1-31(2,3)23-10-12-24(13-11-23)37-28(19-27(36-37)22-6-4-16-33-20-22)34-17-5-7-29(39)35-30(40)26(32)18-21-8-14-25(38)15-9-21/h4,6,8-16,19-20,26,34,38H,5,7,17-18,32H2,1-3H3,(H,35,39,40) |
| InChIKey | HELSTEXWEVIMGG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|