C34H41N5O3 — CID 69252001
N-[(2S)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoyl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide (PubChem CID 69252001) has the molecular formula C34H41N5O3 and a molecular weight of 567.73 g/mol. Its IUPAC name is N-[(2S)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoyl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide.
| Compound Name | N-[(2S)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoyl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 69252001 |
| Molecular Formula | C34H41N5O3 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | N-[(2S)-2-amino-3-[4-(hydroxymethyl)phenyl]propanoyl]-6-[1-(4-tert-butylphenyl)-3-pyridin-2-ylpyrazol-5-yl]hexanamide |
| SMILES | CC(C)(C)c1ccc(-n2nc(-c3ccccn3)cc2CCCCCC(=O)NC(=O)[C@@H](N)Cc2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C34H41N5O3/c1-34(2,3)26-16-18-27(19-17-26)39-28(22-31(38-39)30-10-7-8-20-36-30)9-5-4-6-11-32(41)37-33(42)29(35)21-24-12-14-25(23-40)15-13-24/h7-8,10,12-20,22,29,40H,4-6,9,11,21,23,35H2,1-3H3,(H,37,41,42)/t29-/m0/s1 |
| InChIKey | NSFBBHBQTOEQBG-LJAQVGFWSA-N |
| XLogP | 5.04 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|