C27H28N4O4 — CID 22385829
N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[1-butyl-3-(furan-2-yl)pyrazol-5-yl]benzamide (PubChem CID 22385829) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[1-butyl-3-(furan-2-yl)pyrazol-5-yl]benzamide.
| Compound Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[1-butyl-3-(furan-2-yl)pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 22385829 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[2-amino-3-(4-hydroxyphenyl)propanoyl]-4-[1-butyl-3-(furan-2-yl)pyrazol-5-yl]benzamide |
| SMILES | CCCCn1nc(-c2ccco2)cc1-c1ccc(C(=O)NC(=O)C(N)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-2-3-14-31-24(17-23(30-31)25-5-4-15-35-25)19-8-10-20(11-9-19)26(33)29-27(34)22(28)16-18-6-12-21(32)13-7-18/h4-13,15,17,22,32H,2-3,14,16,28H2,1H3,(H,29,33,34) |
| InChIKey | XTNHXSDSWCROLX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |