C13H26N4 — CID 142226043
N-[2-[[(3E)-5-aminohexa-1,3,5-trien-3-yl]amino]ethyl]-N,N'-dimethylmethanimidamide;ethane (PubChem CID 142226043) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is N-[2-[[(3E)-5-aminohexa-1,3,5-trien-3-yl]amino]ethyl]-N,N'-dimethylmethanimidamide;ethane.
| Compound Name | N-[2-[[(3E)-5-aminohexa-1,3,5-trien-3-yl]amino]ethyl]-N,N'-dimethylmethanimidamide;ethane |
|---|---|
| PubChem CID | 142226043 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | N-[2-[[(3E)-5-aminohexa-1,3,5-trien-3-yl]amino]ethyl]-N,N'-dimethylmethanimidamide;ethane |
| SMILES | C=C/C(=C\C(=C)N)NCCN(C)/C=N/C.CC |
| InChI | InChI=1S/C11H20N4.C2H6/c1-5-11(8-10(2)12)14-6-7-15(4)9-13-3;1-2/h5,8-9,14H,1-2,6-7,12H2,3-4H3;1-2H3/b11-8+,13-9+; |
| InChIKey | BQHJISPJRRQDOZ-HOIAKSQOSA-N |
| XLogP | 1.73 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|