C20H30BrNO2S — CID 142226538
(2Z,5Z)-1-bromo-5-ethylhepta-2,5-diene;N-methyl-5-methylsulfonyl-2-[(E)-prop-1-enyl]aniline (PubChem CID 142226538) has the molecular formula C20H30BrNO2S and a molecular weight of 428.44 g/mol. Its IUPAC name is (2Z,5Z)-1-bromo-5-ethylhepta-2,5-diene;N-methyl-5-methylsulfonyl-2-[(E)-prop-1-enyl]aniline.
| Compound Name | (2Z,5Z)-1-bromo-5-ethylhepta-2,5-diene;N-methyl-5-methylsulfonyl-2-[(E)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 142226538 |
| Molecular Formula | C20H30BrNO2S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (2Z,5Z)-1-bromo-5-ethylhepta-2,5-diene;N-methyl-5-methylsulfonyl-2-[(E)-prop-1-enyl]aniline |
| SMILES | C/C=C(/CC)C/C=C\CBr.C/C=C/c1ccc(S(C)(=O)=O)cc1NC |
| InChI | InChI=1S/C11H15NO2S.C9H15Br/c1-4-5-9-6-7-10(15(3,13)14)8-11(9)12-2;1-3-9(4-2)7-5-6-8-10/h4-8,12H,1-3H3;3,5-6H,4,7-8H2,1-2H3/b5-4+;6-5-,9-3- |
| InChIKey | NHTAIFYRPKOYNQ-WPKJTPRBSA-N |
| XLogP | 5.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|