C32H41N5O2 — CID 142230208
N-[[4-[3-[4-(dimethylamino)quinazolin-2-yl]propyl]cyclohexyl]methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 142230208) has the molecular formula C32H41N5O2 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[[4-[3-[4-(dimethylamino)quinazolin-2-yl]propyl]cyclohexyl]methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[[4-[3-[4-(dimethylamino)quinazolin-2-yl]propyl]cyclohexyl]methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 142230208 |
| Molecular Formula | C32H41N5O2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | N-[[4-[3-[4-(dimethylamino)quinazolin-2-yl]propyl]cyclohexyl]methyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)NCC3CCC(CCCc4nc(N(C)C)c5ccccc5n4)CC3)c2c1 |
| InChI | InChI=1S/C32H41N5O2/c1-21-26(27-18-24(39-4)16-17-29(27)34-21)19-31(38)33-20-23-14-12-22(13-15-23)8-7-11-30-35-28-10-6-5-9-25(28)32(36-30)37(2)3/h5-6,9-10,16-18,22-23,34H,7-8,11-15,19-20H2,1-4H3,(H,33,38) |
| InChIKey | TUTAMWOULBCSIK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|