C10H13N3O2 — CID 142232611
2-(8-oxo-1,2,3,4-tetrahydro-1,7-naphthyridin-7-yl)acetamide (PubChem CID 142232611) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(8-oxo-1,2,3,4-tetrahydro-1,7-naphthyridin-7-yl)acetamide.
| Compound Name | 2-(8-oxo-1,2,3,4-tetrahydro-1,7-naphthyridin-7-yl)acetamide |
|---|---|
| PubChem CID | 142232611 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(8-oxo-1,2,3,4-tetrahydro-1,7-naphthyridin-7-yl)acetamide |
| SMILES | NC(=O)Cn1ccc2c(c1=O)NCCC2 |
| InChI | InChI=1S/C10H13N3O2/c11-8(14)6-13-5-3-7-2-1-4-12-9(7)10(13)15/h3,5,12H,1-2,4,6H2,(H2,11,14) |
| InChIKey | MGBKZGGXGZPIIP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |