C13H18FN3O — CID 175565382
N-ethyl-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide (PubChem CID 175565382) has the molecular formula C13H18FN3O and a molecular weight of 251.30 g/mol. Its IUPAC name is N-ethyl-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide.
| Compound Name | N-ethyl-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 175565382 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-ethyl-2-fluoro-3-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridine-6-carboxamide |
| SMILES | CCNC(=O)C1=CC=C(C2=CCNCC2)C(F)N1 |
| InChI | InChI=1S/C13H18FN3O/c1-2-16-13(18)11-4-3-10(12(14)17-11)9-5-7-15-8-6-9/h3-5,12,15,17H,2,6-8H2,1H3,(H,16,18) |
| InChIKey | BPPDYFFPPZFZCU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|