C11H18S2 — CID 142232645
2-ethylbenzene-1,4-dithiol;propane (PubChem CID 142232645) has the molecular formula C11H18S2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-ethylbenzene-1,4-dithiol;propane.
| Compound Name | 2-ethylbenzene-1,4-dithiol;propane |
|---|---|
| PubChem CID | 142232645 |
| Molecular Formula | C11H18S2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-ethylbenzene-1,4-dithiol;propane |
| SMILES | CCC.CCc1cc(S)ccc1S |
| InChI | InChI=1S/C8H10S2.C3H8/c1-2-6-5-7(9)3-4-8(6)10;1-3-2/h3-5,9-10H,2H2,1H3;3H2,1-2H3 |
| InChIKey | RLUNNLBBCVKSFH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|