C14H14S2 — CID 175582807
2-(2-phenylethyl)benzene-1,4-dithiol (PubChem CID 175582807) has the molecular formula C14H14S2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-(2-phenylethyl)benzene-1,4-dithiol.
| Compound Name | 2-(2-phenylethyl)benzene-1,4-dithiol |
|---|---|
| PubChem CID | 175582807 |
| Molecular Formula | C14H14S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(2-phenylethyl)benzene-1,4-dithiol |
| SMILES | Sc1ccc(S)c(CCc2ccccc2)c1 |
| InChI | InChI=1S/C14H14S2/c15-13-8-9-14(16)12(10-13)7-6-11-4-2-1-3-5-11/h1-5,8-10,15-16H,6-7H2 |
| InChIKey | VDYSCQWKKFJYHK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|