C14H24N2O4 — CID 142233418
tert-butyl (4S)-3-methyl-4-[(E)-2-nitrobut-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 142233418) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl (4S)-3-methyl-4-[(E)-2-nitrobut-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-methyl-4-[(E)-2-nitrobut-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142233418 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | tert-butyl (4S)-3-methyl-4-[(E)-2-nitrobut-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CC/C(=C\[C@H]1CN(C(=O)OC(C)(C)C)CC1C)[N+](=O)[O-] |
| InChI | InChI=1S/C14H24N2O4/c1-6-12(16(18)19)7-11-9-15(8-10(11)2)13(17)20-14(3,4)5/h7,10-11H,6,8-9H2,1-5H3/b12-7+/t10?,11-/m0/s1 |
| InChIKey | XGALXDNLTSMSNY-GNMRCVCQSA-N |
| XLogP | 3.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|