C16H30O2 — CID 142233534
5,6-bis(ethenyl)-3,4-dihydro-2H-pyran-2-carbaldehyde;ethane (PubChem CID 142233534) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3,4-dihydro-2H-pyran-2-carbaldehyde;ethane.
| Compound Name | 5,6-bis(ethenyl)-3,4-dihydro-2H-pyran-2-carbaldehyde;ethane |
|---|---|
| PubChem CID | 142233534 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 5,6-bis(ethenyl)-3,4-dihydro-2H-pyran-2-carbaldehyde;ethane |
| SMILES | C=CC1=C(C=C)OC(C=O)CC1.CC.CC.CC |
| InChI | InChI=1S/C10H12O2.3C2H6/c1-3-8-5-6-9(7-11)12-10(8)4-2;3*1-2/h3-4,7,9H,1-2,5-6H2;3*1-2H3 |
| InChIKey | NIUFYLGHZYAOBX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|