C12H18O2 — CID 123899341
2-(1-cyclohexa-1,3-dien-1-ylethoxy)butanal (PubChem CID 123899341) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(1-cyclohexa-1,3-dien-1-ylethoxy)butanal.
| Compound Name | 2-(1-cyclohexa-1,3-dien-1-ylethoxy)butanal |
|---|---|
| PubChem CID | 123899341 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(1-cyclohexa-1,3-dien-1-ylethoxy)butanal |
| SMILES | CCC(C=O)OC(C)C1=CC=CCC1 |
| InChI | InChI=1S/C12H18O2/c1-3-12(9-13)14-10(2)11-7-5-4-6-8-11/h4-5,7,9-10,12H,3,6,8H2,1-2H3 |
| InChIKey | QAGNFHHWRZPMGS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|