C11H18O2 — CID 123755669
2-(3-methylhexa-3,5-dien-2-yloxy)butanal (PubChem CID 123755669) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-(3-methylhexa-3,5-dien-2-yloxy)butanal.
| Compound Name | 2-(3-methylhexa-3,5-dien-2-yloxy)butanal |
|---|---|
| PubChem CID | 123755669 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-(3-methylhexa-3,5-dien-2-yloxy)butanal |
| SMILES | C=CC=C(C)C(C)OC(C=O)CC |
| InChI | InChI=1S/C11H18O2/c1-5-7-9(3)10(4)13-11(6-2)8-12/h5,7-8,10-11H,1,6H2,2-4H3 |
| InChIKey | CMJZMDQKLYKCGR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|