C8H9IO2 — CID 89306007
5-(2-iodoethenyl)-3,6-dihydro-2H-pyran-2-carbaldehyde (PubChem CID 89306007) has the molecular formula C8H9IO2 and a molecular weight of 264.06 g/mol. Its IUPAC name is 5-(2-iodoethenyl)-3,6-dihydro-2H-pyran-2-carbaldehyde.
| Compound Name | 5-(2-iodoethenyl)-3,6-dihydro-2H-pyran-2-carbaldehyde |
|---|---|
| PubChem CID | 89306007 |
| Molecular Formula | C8H9IO2 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 5-(2-iodoethenyl)-3,6-dihydro-2H-pyran-2-carbaldehyde |
| SMILES | O=CC1CC=C(C=CI)CO1 |
| InChI | InChI=1S/C8H9IO2/c9-4-3-7-1-2-8(5-10)11-6-7/h1,3-5,8H,2,6H2 |
| InChIKey | WRPGJWHGXLNUOX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|