About 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal
3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal (PubChem CID 89216155) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal.
Molecular Properties
| Compound Name | 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal |
| PubChem CID | 89216155 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal |
| SMILES | CCCCCCCO[C@@H]1C=CC(CCC=O)=CC1 |
| InChI | InChI=1S/C16H26O2/c1-2-3-4-5-6-14-18-16-11-9-15(10-12-16)8-7-13-17/h9-11,13,16H,2-8,12,14H2,1H3/t16-/m1/s1 |
| InChIKey | XMNUTIJCXZIOLT-MRXNPFEDSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal?
The IUPAC name of 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal (CID 89216155) is 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal.
What is the SMILES notation for 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal?
The canonical SMILES for 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal is CCCCCCCO[C@@H]1C=CC(CCC=O)=CC1.
What is the InChIKey of 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal?
The InChIKey is XMNUTIJCXZIOLT-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H26O2/c1-2-3-4-5-6-14-18-16-11-9-15(10-12-16)8-7-13-17/h9-11,13,16H,2-8,12,14H2,1H3/t16-/m1/s1.
What are the key properties of 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal?
3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal has a molecular weight of 250.38 g/mol, XLogP of 4.21, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal is sourced from PubChem (CID 89216155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).