C16H26O2 — CID 89216155
3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal (PubChem CID 89216155) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal.
| Compound Name | 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal |
|---|---|
| PubChem CID | 89216155 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-[(4S)-4-heptoxycyclohexa-1,5-dien-1-yl]propanal |
| SMILES | CCCCCCCO[C@@H]1C=CC(CCC=O)=CC1 |
| InChI | InChI=1S/C16H26O2/c1-2-3-4-5-6-14-18-16-11-9-15(10-12-16)8-7-13-17/h9-11,13,16H,2-8,12,14H2,1H3/t16-/m1/s1 |
| InChIKey | XMNUTIJCXZIOLT-MRXNPFEDSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|