C12H13O2Y- — CID 59215282
7,8-dimethyl-2,3,4,6-tetrahydrochromen-6-ide-2-carbaldehyde;yttrium (PubChem CID 59215282) has the molecular formula C12H13O2Y- and a molecular weight of 278.14 g/mol. Its IUPAC name is 7,8-dimethyl-2,3,4,6-tetrahydrochromen-6-ide-2-carbaldehyde;yttrium.
| Compound Name | 7,8-dimethyl-2,3,4,6-tetrahydrochromen-6-ide-2-carbaldehyde;yttrium |
|---|---|
| PubChem CID | 59215282 |
| Molecular Formula | C12H13O2Y- |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 7,8-dimethyl-2,3,4,6-tetrahydrochromen-6-ide-2-carbaldehyde;yttrium |
| SMILES | Cc1[c-]cc2c(c1C)OC(C=O)CC2.[Y] |
| InChI | InChI=1S/C12H13O2.Y/c1-8-3-4-10-5-6-11(7-13)14-12(10)9(8)2;/h4,7,11H,5-6H2,1-2H3;/q-1; |
| InChIKey | YDTNJFORLSTHRV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|