C12H14O2 — CID 143559704
3-(7,8-dihydro-2H-chromen-4-yl)propanal (PubChem CID 143559704) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-(7,8-dihydro-2H-chromen-4-yl)propanal.
| Compound Name | 3-(7,8-dihydro-2H-chromen-4-yl)propanal |
|---|---|
| PubChem CID | 143559704 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-(7,8-dihydro-2H-chromen-4-yl)propanal |
| SMILES | O=CCCC1=CCOC2=C1C=CCC2 |
| InChI | InChI=1S/C12H14O2/c13-8-3-4-10-7-9-14-12-6-2-1-5-11(10)12/h1,5,7-8H,2-4,6,9H2 |
| InChIKey | KVIQITJYPPMSPI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|