C10H10O3 — CID 148940071
2-(7,8-dihydro-1,4-benzodioxin-6-yl)acetaldehyde (PubChem CID 148940071) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(7,8-dihydro-1,4-benzodioxin-6-yl)acetaldehyde.
| Compound Name | 2-(7,8-dihydro-1,4-benzodioxin-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 148940071 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-(7,8-dihydro-1,4-benzodioxin-6-yl)acetaldehyde |
| SMILES | O=CCC1=CC2=C(CC1)OC=CO2 |
| InChI | InChI=1S/C10H10O3/c11-4-3-8-1-2-9-10(7-8)13-6-5-12-9/h4-7H,1-3H2 |
| InChIKey | PNSKBYDQRAUKPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|