C10H8O3 — CID 143142975
4-oxo-5,6-dihydrochromene-3-carbaldehyde (PubChem CID 143142975) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is 4-oxo-5,6-dihydrochromene-3-carbaldehyde.
| Compound Name | 4-oxo-5,6-dihydrochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 143142975 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 4-oxo-5,6-dihydrochromene-3-carbaldehyde |
| SMILES | O=Cc1coc2c(c1=O)CCC=C2 |
| InChI | InChI=1S/C10H8O3/c11-5-7-6-13-9-4-2-1-3-8(9)10(7)12/h2,4-6H,1,3H2 |
| InChIKey | USKYMMKNMAJQEM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|