C17H18N4O4S2 — CID 142234183
3-hydroxy-N,N-dimethyl-4-[[1-methyl-2,5-dioxo-4-(thiophen-2-ylmethylamino)pyrrol-3-yl]amino]thiophene-2-carboxamide (PubChem CID 142234183) has the molecular formula C17H18N4O4S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-4-[[1-methyl-2,5-dioxo-4-(thiophen-2-ylmethylamino)pyrrol-3-yl]amino]thiophene-2-carboxamide.
| Compound Name | 3-hydroxy-N,N-dimethyl-4-[[1-methyl-2,5-dioxo-4-(thiophen-2-ylmethylamino)pyrrol-3-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 142234183 |
| Molecular Formula | C17H18N4O4S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-4-[[1-methyl-2,5-dioxo-4-(thiophen-2-ylmethylamino)pyrrol-3-yl]amino]thiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1scc(NC2=C(NCc3cccs3)C(=O)N(C)C2=O)c1O |
| InChI | InChI=1S/C17H18N4O4S2/c1-20(2)17(25)14-13(22)10(8-27-14)19-12-11(15(23)21(3)16(12)24)18-7-9-5-4-6-26-9/h4-6,8,18-19,22H,7H2,1-3H3 |
| InChIKey | UUXCWJXSECOUON-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|