C23H29NO2 — CID 142234828
(12aS)-2-(cyclopropylmethyl)-8-hydroxy-12a-methyl-3-methylidene-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinolin-1-one (PubChem CID 142234828) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (12aS)-2-(cyclopropylmethyl)-8-hydroxy-12a-methyl-3-methylidene-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinolin-1-one.
| Compound Name | (12aS)-2-(cyclopropylmethyl)-8-hydroxy-12a-methyl-3-methylidene-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinolin-1-one |
|---|---|
| PubChem CID | 142234828 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (12aS)-2-(cyclopropylmethyl)-8-hydroxy-12a-methyl-3-methylidene-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinolin-1-one |
| SMILES | C=C1CC2C3CCc4cc(O)ccc4C3CC[C@]2(C)C(=O)N1CC1CC1 |
| InChI | InChI=1S/C23H29NO2/c1-14-11-21-20-7-5-16-12-17(25)6-8-18(16)19(20)9-10-23(21,2)22(26)24(14)13-15-3-4-15/h6,8,12,15,19-21,25H,1,3-5,7,9-11,13H2,2H3/t19?,20?,21?,23-/m0/s1 |
| InChIKey | MCWQPDDKQWDQKY-FTKYIGPGSA-N |
| XLogP | 4.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |