C21H25NO3 — CID 4315821
8-hydroxy-12a-methyl-2-prop-2-enyl-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinoline-1,3-dione (PubChem CID 4315821) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 8-hydroxy-12a-methyl-2-prop-2-enyl-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinoline-1,3-dione.
| Compound Name | 8-hydroxy-12a-methyl-2-prop-2-enyl-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4315821 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 8-hydroxy-12a-methyl-2-prop-2-enyl-4,4a,4b,5,6,10b,11,12-octahydronaphtho[2,1-f]isoquinoline-1,3-dione |
| SMILES | C=CCN1C(=O)CC2C3CCc4cc(O)ccc4C3CCC2(C)C1=O |
| InChI | InChI=1S/C21H25NO3/c1-3-10-22-19(24)12-18-17-6-4-13-11-14(23)5-7-15(13)16(17)8-9-21(18,2)20(22)25/h3,5,7,11,16-18,23H,1,4,6,8-10,12H2,2H3 |
| InChIKey | XEYVVHPJJHRUPE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|