C9H8N4O4S — CID 1422361
5-[(4-nitrophenyl)methylsulfonyl]-1H-1,2,4-triazole (PubChem CID 1422361) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is 5-[(4-nitrophenyl)methylsulfonyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(4-nitrophenyl)methylsulfonyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 1422361 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-[(4-nitrophenyl)methylsulfonyl]-1H-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(CS(=O)(=O)c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C9H8N4O4S/c14-13(15)8-3-1-7(2-4-8)5-18(16,17)9-10-6-11-12-9/h1-4,6H,5H2,(H,10,11,12) |
| InChIKey | JWQCDIQVGAMYKJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|