C9H13NO2 — CID 142237329
4-(2-aminoethyl)cyclohepta-1,3,6-triene-1,2-diol (PubChem CID 142237329) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-(2-aminoethyl)cyclohepta-1,3,6-triene-1,2-diol.
| Compound Name | 4-(2-aminoethyl)cyclohepta-1,3,6-triene-1,2-diol |
|---|---|
| PubChem CID | 142237329 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-(2-aminoethyl)cyclohepta-1,3,6-triene-1,2-diol |
| SMILES | NCCC1=CC(O)=C(O)C=CC1 |
| InChI | InChI=1S/C9H13NO2/c10-5-4-7-2-1-3-8(11)9(12)6-7/h1,3,6,11-12H,2,4-5,10H2 |
| InChIKey | XBMHUMUWDWDCCY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |