C13H23NO — CID 88964788
(2Z,4Z,7Z)-6-(2-aminoethyl)-7-methyldeca-2,4,7-trien-4-ol (PubChem CID 88964788) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2Z,4Z,7Z)-6-(2-aminoethyl)-7-methyldeca-2,4,7-trien-4-ol.
| Compound Name | (2Z,4Z,7Z)-6-(2-aminoethyl)-7-methyldeca-2,4,7-trien-4-ol |
|---|---|
| PubChem CID | 88964788 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2Z,4Z,7Z)-6-(2-aminoethyl)-7-methyldeca-2,4,7-trien-4-ol |
| SMILES | C/C=C\C(O)=C\C(CCN)/C(C)=C\CC |
| InChI | InChI=1S/C13H23NO/c1-4-6-11(3)12(8-9-14)10-13(15)7-5-2/h5-7,10,12,15H,4,8-9,14H2,1-3H3/b7-5-,11-6-,13-10- |
| InChIKey | CZGVJPLOZNBLJO-ZEZZKKRISA-N |
| XLogP | 3.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|