C9H13NO — CID 142109544
4-(2-aminoethyl)cyclohepta-1,3,6-trien-1-ol (PubChem CID 142109544) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(2-aminoethyl)cyclohepta-1,3,6-trien-1-ol.
| Compound Name | 4-(2-aminoethyl)cyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 142109544 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(2-aminoethyl)cyclohepta-1,3,6-trien-1-ol |
| SMILES | NCCC1=CC=C(O)C=CC1 |
| InChI | InChI=1S/C9H13NO/c10-7-6-8-2-1-3-9(11)5-4-8/h1,3-5,11H,2,6-7,10H2 |
| InChIKey | HEAAUUABLJSYBJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |