C30H31Cl2N5O2 — CID 142237733
1-[[4-(3-cyanophenyl)phenyl]methyl]-1-[1-(3,5-dichloroanilino)-3-oxopropan-2-yl]-3-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 142237733) has the molecular formula C30H31Cl2N5O2 and a molecular weight of 564.52 g/mol. Its IUPAC name is 1-[[4-(3-cyanophenyl)phenyl]methyl]-1-[1-(3,5-dichloroanilino)-3-oxopropan-2-yl]-3-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[[4-(3-cyanophenyl)phenyl]methyl]-1-[1-(3,5-dichloroanilino)-3-oxopropan-2-yl]-3-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 142237733 |
| Molecular Formula | C30H31Cl2N5O2 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 1-[[4-(3-cyanophenyl)phenyl]methyl]-1-[1-(3,5-dichloroanilino)-3-oxopropan-2-yl]-3-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | N#Cc1cccc(-c2ccc(CN(C(=O)NCCN3CCCC3)C(C=O)CNc3cc(Cl)cc(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C30H31Cl2N5O2/c31-26-15-27(32)17-28(16-26)35-19-29(21-38)37(30(39)34-10-13-36-11-1-2-12-36)20-22-6-8-24(9-7-22)25-5-3-4-23(14-25)18-33/h3-9,14-17,21,29,35H,1-2,10-13,19-20H2,(H,34,39) |
| InChIKey | LFLVVTVVVYJDPP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|