C13H24N2O — CID 142239100
ethane;(3Z)-N-methyl-5-morpholin-4-ylhexa-1,3,5-trien-2-amine (PubChem CID 142239100) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;(3Z)-N-methyl-5-morpholin-4-ylhexa-1,3,5-trien-2-amine.
| Compound Name | ethane;(3Z)-N-methyl-5-morpholin-4-ylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142239100 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | ethane;(3Z)-N-methyl-5-morpholin-4-ylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)N1CCOCC1)NC.CC |
| InChI | InChI=1S/C11H18N2O.C2H6/c1-10(12-3)4-5-11(2)13-6-8-14-9-7-13;1-2/h4-5,12H,1-2,6-9H2,3H3;1-2H3/b5-4-; |
| InChIKey | HKRGZMOHCWFDNF-MKWAYWHRSA-N |
| XLogP | 2.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|