C12H20N2O2S — CID 142240252
N'-[(2Z)-2-sulfanylpenta-2,4-dienoyl]heptanehydrazide (PubChem CID 142240252) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N'-[(2Z)-2-sulfanylpenta-2,4-dienoyl]heptanehydrazide.
| Compound Name | N'-[(2Z)-2-sulfanylpenta-2,4-dienoyl]heptanehydrazide |
|---|---|
| PubChem CID | 142240252 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N'-[(2Z)-2-sulfanylpenta-2,4-dienoyl]heptanehydrazide |
| SMILES | C=C/C=C(\S)C(=O)NNC(=O)CCCCCC |
| InChI | InChI=1S/C12H20N2O2S/c1-3-5-6-7-9-11(15)13-14-12(16)10(17)8-4-2/h4,8,17H,2-3,5-7,9H2,1H3,(H,13,15)(H,14,16)/b10-8- |
| InChIKey | VWLXKJJMNACKHL-NTMALXAHSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|