C32H45FN4O — CID 142242373
1-(dipropylamino)-N-[3-[(3-ethylphenyl)methylamino]propyl]isoquinoline-7-carboxamide;(E)-1-fluorobut-1-ene (PubChem CID 142242373) has the molecular formula C32H45FN4O and a molecular weight of 520.74 g/mol. Its IUPAC name is 1-(dipropylamino)-N-[3-[(3-ethylphenyl)methylamino]propyl]isoquinoline-7-carboxamide;(E)-1-fluorobut-1-ene.
| Compound Name | 1-(dipropylamino)-N-[3-[(3-ethylphenyl)methylamino]propyl]isoquinoline-7-carboxamide;(E)-1-fluorobut-1-ene |
|---|---|
| PubChem CID | 142242373 |
| Molecular Formula | C32H45FN4O |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | 1-(dipropylamino)-N-[3-[(3-ethylphenyl)methylamino]propyl]isoquinoline-7-carboxamide;(E)-1-fluorobut-1-ene |
| SMILES | CC/C=C/F.CCCN(CCC)c1nccc2ccc(C(=O)NCCCNCc3cccc(CC)c3)cc12 |
| InChI | InChI=1S/C28H38N4O.C4H7F/c1-4-17-32(18-5-2)27-26-20-25(12-11-24(26)13-16-30-27)28(33)31-15-8-14-29-21-23-10-7-9-22(6-3)19-23;1-2-3-4-5/h7,9-13,16,19-20,29H,4-6,8,14-15,17-18,21H2,1-3H3,(H,31,33);3-4H,2H2,1H3/b;4-3+ |
| InChIKey | DTLDKHFOKNVEDP-SCBDLNNBSA-N |
| XLogP | 7.21 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|