C17H34N2O — CID 142243925
ethane;N-(4-ethylphenyl)-4-methyl-2-(methylamino)pentanamide;molecular hydrogen (PubChem CID 142243925) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;N-(4-ethylphenyl)-4-methyl-2-(methylamino)pentanamide;molecular hydrogen.
| Compound Name | ethane;N-(4-ethylphenyl)-4-methyl-2-(methylamino)pentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 142243925 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | ethane;N-(4-ethylphenyl)-4-methyl-2-(methylamino)pentanamide;molecular hydrogen |
| SMILES | CC.CCc1ccc(NC(=O)C(CC(C)C)NC)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C15H24N2O.C2H6.2H2/c1-5-12-6-8-13(9-7-12)17-15(18)14(16-4)10-11(2)3;1-2;;/h6-9,11,14,16H,5,10H2,1-4H3,(H,17,18);1-2H3;2*1H |
| InChIKey | NFCPFCRQFXLGIZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |