C11H13Cl2NS — CID 142246649
(E)-1-[(2,7-dichlorocyclohepta-1,3,6-trien-1-yl)amino]but-1-ene-1-thiol (PubChem CID 142246649) has the molecular formula C11H13Cl2NS and a molecular weight of 262.20 g/mol. Its IUPAC name is (E)-1-[(2,7-dichlorocyclohepta-1,3,6-trien-1-yl)amino]but-1-ene-1-thiol.
| Compound Name | (E)-1-[(2,7-dichlorocyclohepta-1,3,6-trien-1-yl)amino]but-1-ene-1-thiol |
|---|---|
| PubChem CID | 142246649 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | (E)-1-[(2,7-dichlorocyclohepta-1,3,6-trien-1-yl)amino]but-1-ene-1-thiol |
| SMILES | CC/C=C(/S)NC1=C(Cl)C=CCC=C1Cl |
| InChI | InChI=1S/C11H13Cl2NS/c1-2-5-10(15)14-11-8(12)6-3-4-7-9(11)13/h3,5-7,14-15H,2,4H2,1H3/b10-5+ |
| InChIKey | XDOQWQXECSLSOF-BJMVGYQFSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|